Systematic / IUPAC Name: N-(2,4-Difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]nicotinamide
ID: Reference45
Other Names:
N-(2,4-Difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide;
3-Pyridinecarboxamide, N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]-
Formula: C19H11F5N2O2
Class: Pesticides/Herbicides
Diflufenican mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 5557 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7, MS8 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/15/2015 12:20:05 PM |
| InChI | InChI=1S/C19H11F5N2O2/c20-12-6-7-16(15(21)10-12)26-17(27)14-5-2-8-25-18(14)28-13-4-1-3-11(9-13)19(22,23)24/h1-10H,(H,26,27) |
| InChI Key | WYEHFWKAOXOVJD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)OC2=C(C=CC=N2)C(=O)NC3=C(C=C(C=C3)F)F)C(F)(F)F |
| CAS | 83164334 |
| Splash | |
| Other Names |
N-(2,4-Difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide; 3-Pyridinecarboxamide, N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]- |
| ChemSpider | 82834 |
| PubChem | 91735 |
| ChemIDPlus | 083164334 |
| ChEMBL | CHEMBL1425995 |