Systematic / IUPAC Name: 2,6-Bis[(2-hydroxyethyl)amino]-3-nitrobenzonitrile
ID: Reference4500
Other Names: Benzonitrile, 2,6-bis[(2-hydroxyethyl)amino]-3-nitro-
Formula: C11H14N4O4
2,6-Bis[(2-hydroxyethyl)amino]-3-nitrobenzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 11:34:08 AM |
| InChI | InChI=1S/C11H14N4O4/c12-7-8-9(13-3-5-16)1-2-10(15(18)19)11(8)14-4-6-17/h1-2,13-14,16-17H,3-6H2 |
| InChI Key | QGBZZLLYHLIVEP-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzonitrile, 2,6-bis[(2-hydroxyethyl)amino]-3-nitro- |
| ChemSpider | 2083345 |
| ChEMBL | CHEMBL1421121 |
| PubChem | 2804805 |