Systematic / IUPAC Name: [(2-Oxo-2-{4-[4-(trifluoromethyl)-2-pyrimidinyl]-1,4-diazepan-1-yl}ethyl)sulfanyl]acetic acid
ID: Reference4504
Other Names: Acetic acid, 2-[(2-{hexahydro-4-[4-(trifluoromethyl)-2-pyrimidinyl]-1H-1,4-diazepin-1-yl}-2-oxoethyl)thio]-
Formula: C14H17F3N4O3S
2-[(2-Oxo-2-{4-[4-(trifluoromethyl)-2-pyrimidinyl]-1,4-diazepan-1-yl}ethyl)sulfanyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 12:32:47 PM |
| InChI | InChI=1S/C14H17F3N4O3S/c15-14(16,17)10-2-3-18-13(19-10)21-5-1-4-20(6-7-21)11(22)8-25-9-12(23)24/h2-3H,1,4-9H2,(H,23,24) |
| InChI Key | SUCWPEPAYNPBKK-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN(C1)C(=O)CSCC(=O)O)C2=NC=CC(=N2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-[(2-{hexahydro-4-[4-(trifluoromethyl)-2-pyrimidinyl]-1H-1,4-diazepin-1-yl}-2-oxoethyl)thio]- |
| ChemSpider | 2089243 |
| PubChem | 2810828 |
| ChEMBL | CHEMBL1335372 |