Systematic / IUPAC Name: 2-[3-(4-Phenyl-1-piperazinyl)propoxy]benzamide
ID: Reference4512
Other Names: Benzamide, 2-[3-(4-phenyl-1-piperazinyl)propoxy]-
Formula: C20H25N3O2
2-[3-(4-Phenylpiperazino)propoxy]benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/12/2016 7:40:11 AM |
| InChI | InChI=1S/C20H25N3O2/c21-20(24)18-9-4-5-10-19(18)25-16-6-11-22-12-14-23(15-13-22)17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2,(H2,21,24) |
| InChI Key | GBSHKERFECNDBW-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1CCCOC2=CC=CC=C2C(=O)N)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Benzamide, 2-[3-(4-phenyl-1-piperazinyl)propoxy]- |
| PubChem | 2729859 |
| ChemSpider | 2011803 |
| ChEMBL | CHEMBL2234893 |