Systematic / IUPAC Name: {2-[(4-Fluoro-1-methyl-1H-indazol-3-yl)amino]-2-oxoethoxy}acetic acid
ID: Reference4513
Other Names:
2-{[(4-Fluoro-1-methyl-1H-indazol-3-yl)carbamoyl]methoxy}acetic acid;
Acetic acid, 2-{2-[(4-fluoro-1-methyl-1H-indazol-3-yl)amino]-2-oxoethoxy}-
Formula: C12H12FN3O4
2-{2-[(4-Fluoro-1-methyl-1H-indazol-3-yl)amino]-2-oxoethoxy}acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 227 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/12/2016 11:25:26 AM |
| InChI | InChI=1S/C12H12FN3O4/c1-16-8-4-2-3-7(13)11(8)12(15-16)14-9(17)5-20-6-10(18)19/h2-4H,5-6H2,1H3,(H,18,19)(H,14,15,17) |
| InChI Key | YTZSVVFDQXTART-UHFFFAOYSA-N |
| Canonical SMILES | CN1C2=C(C(=CC=C2)F)C(=N1)NC(=O)COCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
2-{[(4-Fluoro-1-methyl-1H-indazol-3-yl)carbamoyl]methoxy}acetic acid; Acetic acid, 2-{2-[(4-fluoro-1-methyl-1H-indazol-3-yl)amino]-2-oxoethoxy}- |