Systematic / IUPAC Name: 4-Methyl-6-[(2E)-2-(2-pyridinylmethylene)hydrazino]-1,3,5-triazin-2-amine
ID: Reference4522
Other Names: 2-Pyridinecarboxaldehyde, 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)hydrazone
Formula: C10H11N7
2-Pyridinecarbaldehyde N-(4-amino-6-methyl-1,3,5-triazin-2-yl)hydrazone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/12/2016 11:48:15 AM |
| InChI | InChI=1S/C10H11N7/c1-7-14-9(11)16-10(15-7)17-13-6-8-4-2-3-5-12-8/h2-6H,1H3,(H3,11,14,15,16,17)/b13-6+ |
| InChI Key | WDDQRRKGTBKYBP-AWNIVKPZSA-N |
| Canonical SMILES | CC1=NC(=NC(=N1)NN=CC2=CC=CC=N2)N |
| CAS | |
| Splash | |
| Other Names | 2-Pyridinecarboxaldehyde, 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)hydrazone |