Systematic / IUPAC Name: N-(2-Chlorophenyl)-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-thiazol-2-amine
ID: Reference4523
Other Names: 2-Thiazolamine, N-(2-chlorophenyl)-4-(5-methyl-3-phenyl-4-isoxazolyl)-
Formula: C19H14ClN3OS
N2-(2-Chlorophenyl)-4-(5-methyl-3-phenylisoxazol-4-yl)-1,3-thiazol-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/12/2016 11:46:37 AM |
| InChI | InChI=1S/C19H14ClN3OS/c1-12-17(18(23-24-12)13-7-3-2-4-8-13)16-11-25-19(22-16)21-15-10-6-5-9-14(15)20/h2-11H,1H3,(H,21,22) |
| InChI Key | DSNXYXBRCMXCHA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=CSC(=N3)NC4=CC=CC=C4Cl |
| CAS | |
| Splash | |
| Other Names | 2-Thiazolamine, N-(2-chlorophenyl)-4-(5-methyl-3-phenyl-4-isoxazolyl)- |