Systematic / IUPAC Name: 2-(Cyanoacetyl)-N-cyclohexylhydrazinecarbothioamide
ID: Reference4527
Other Names: Acetic acid, 2-cyano, 2-[(cyclohexylamino)thioxomethyl]hydrazide
Formula: C10H16N4OS
N1-Cyclohexyl-2-(2-cyanoacetyl)hydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 230 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/12/2016 1:19:31 PM |
| InChI | InChI=1S/C10H16N4OS/c11-7-6-9(15)13-14-10(16)12-8-4-2-1-3-5-8/h8H,1-6H2,(H,13,15)(H2,12,14,16) |
| InChI Key | MUPBSNIPOIWRTQ-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)NC(=S)NNC(=O)CC#N |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-cyano, 2-[(cyclohexylamino)thioxomethyl]hydrazide |