Systematic / IUPAC Name: N-Allyl-2-({4-methyl-5-[(2-thienylsulfanyl)methyl]-4H-1,2,4-triazol-3-yl}sulfanyl)acetamide
ID: Reference4531
Other Names: Acetamide, 2-({4-methyl-5-[(2-thienylthio)methyl]-4H-1,2,4-triazol-3-yl}thio)-N-2-propen-1-yl-
Formula: C13H16N4OS3
N1-Allyl-2-({4-methyl-5-[(2-thienylthio)methyl]-4H-1,2,4-triazol-3-yl}thio)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/12/2016 2:29:13 PM |
| InChI | InChI=1S/C13H16N4OS3/c1-3-6-14-11(18)9-21-13-16-15-10(17(13)2)8-20-12-5-4-7-19-12/h3-5,7H,1,6,8-9H2,2H3,(H,14,18) |
| InChI Key | BTXVACWIZORWNM-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=NN=C1SCC(=O)NCC=C)CSC2=CC=CS2 |
| CAS | |
| Splash | |
| Other Names | Acetamide, 2-({4-methyl-5-[(2-thienylthio)methyl]-4H-1,2,4-triazol-3-yl}thio)-N-2-propen-1-yl- |