Systematic / IUPAC Name: N-(3-{[(3,4-Dichlorophenyl)carbamothioyl]amino}-4-methylphenyl)acetamide
ID: Reference4540
Other Names: Acetamide, N-[3-({[(3,4-dichlorophenyl)amino]thioxomethyl}amino)-4-methylphenyl]-
Formula: C16H15Cl2N3OS
N1-(3-{[(3,4-Dichloroanilino)carbothioyl]amino}-4-methylphenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 230 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/13/2016 11:47:00 AM |
| InChI | InChI=1S/C16H15Cl2N3OS/c1-9-3-4-12(19-10(2)22)8-15(9)21-16(23)20-11-5-6-13(17)14(18)7-11/h3-8H,1-2H3,(H,19,22)(H2,20,21,23) |
| InChI Key | ZWANPRVMNGGNCI-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(C=C1)NC(=O)C)NC(=S)NC2=CC(=C(C=C2)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-[3-({[(3,4-dichlorophenyl)amino]thioxomethyl}amino)-4-methylphenyl]- |