Systematic / IUPAC Name: 3-[(3-Phenoxyphenyl)acetyl]benzonitrile
ID: Reference4541
Other Names: Benzonitrile, 3-[2-(3-phenoxyphenyl)acetyl]-
Formula: C21H15NO2
3-[2-(3-Phenoxyphenyl)acetyl]benzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/13/2016 1:13:58 PM |
| InChI | InChI=1S/C21H15NO2/c22-15-17-7-4-8-18(12-17)21(23)14-16-6-5-11-20(13-16)24-19-9-2-1-3-10-19/h1-13H,14H2 |
| InChI Key | CMMDWFJQYJTCHH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)CC(=O)C3=CC=CC(=C3)C#N |
| CAS | |
| Splash | |
| Other Names | Benzonitrile, 3-[2-(3-phenoxyphenyl)acetyl]- |