Systematic / IUPAC Name: (4E)-4-{[(4,6-Dimethoxy-2-pyrimidinyl)amino]methylene}-2-phenyl-1,3-oxazol-5(4H)-one
ID: Reference4554
Other Names: 5(4H)-Oxazolone, 4-{[(4,6-dimethoxy-2-pyrimidinyl)amino]methylene}-2-phenyl-, (4E)-
Formula: C16H14N4O4
4-{[(4,6-Dimethoxypyrimidin-2-yl)amino]methylidene}-2-phenyl-4,5-dihydro-1,3-oxazol-5-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/14/2016 10:55:30 AM |
| InChI | InChI=1S/C16H14N4O4/c1-22-12-8-13(23-2)20-16(19-12)17-9-11-15(21)24-14(18-11)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,17,19,20)/b11-9+ |
| InChI Key | OLBWIPXYJNWIAP-PKNBQFBNSA-N |
| Canonical SMILES | COC1=CC(=NC(=N1)NC=C2C(=O)OC(=N2)C3=CC=CC=C3)OC |
| CAS | |
| Splash | |
| Other Names | 5(4H)-Oxazolone, 4-{[(4,6-dimethoxy-2-pyrimidinyl)amino]methylene}-2-phenyl-, (4E)- |