Systematic / IUPAC Name: (2E)-4-{2-[2-(Methoxycarbonyl)-3-thienyl]hydrazino}-3-methyl-4-oxo-2-butenoic acid
ID: Reference4561
Other Names: 2-Butenedioic acid, 2-methyl-, 1-{2-[2-(methoxycarbonyl)-3-thienyl]hydrazide}, (2E)-
Formula: C11H12N2O5S
4-{2-[2-(Methoxycarbonyl)-3-thienyl]hydrazino}-3-methyl-4-oxo-2-butenoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/14/2016 1:04:08 PM |
| InChI | InChI=1S/C11H12N2O5S/c1-6(5-8(14)15)10(16)13-12-7-3-4-19-9(7)11(17)18-2/h3-5,12H,1-2H3,(H,13,16)(H,14,15)/b6-5+ |
| InChI Key | VDABCUHITKSXSD-AATRIKPKSA-N |
| Canonical SMILES | CC(=CC(=O)O)C(=O)NNC1=C(SC=C1)C(=O)OC |
| CAS | |
| Splash | |
| Other Names | 2-Butenedioic acid, 2-methyl-, 1-{2-[2-(methoxycarbonyl)-3-thienyl]hydrazide}, (2E)- |