Systematic / IUPAC Name: 1-(1-Benzothiophen-3-yl)-3-[3-(1H-pyrrol-1-yl)phenyl]urea
ID: Reference4569
Other Names:
N-(1-Benzothiophen-3-yl)-N'-[3-(1H-pyrrol-1-yl)phenyl]urea ;
Urea, N-benzo[b]thien-3-yl-N'-[3-(1H-pyrrol-1-yl)phenyl]-
Formula: C19H15N3OS
N-(1-Benzothiophen-3-yl)-N'-[3-(1H-pyrrol-1-yl)phenyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/15/2016 8:13:43 AM |
| InChI | InChI=1S/C19H15N3OS/c23-19(21-17-13-24-18-9-2-1-8-16(17)18)20-14-6-5-7-15(12-14)22-10-3-4-11-22/h1-13H,(H2,20,21,23) |
| InChI Key | GBAGXDRXBZZUJI-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CS2)NC(=O)NC3=CC=CC(=C3)N4C=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
N-(1-Benzothiophen-3-yl)-N'-[3-(1H-pyrrol-1-yl)phenyl]urea ; Urea, N-benzo[b]thien-3-yl-N'-[3-(1H-pyrrol-1-yl)phenyl]- |