Systematic / IUPAC Name: N'-(4-Cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)-N,N-dimethylimidoformamide
ID: Reference4575
Other Names: Methanimidamide, N'-(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)-N,N-dimethyl-
Formula: C16H15N5
N'-(4-Cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)-N,N-dimethyliminoformamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/15/2016 12:29:46 PM |
| InChI | InChI=1S/C16H15N5/c1-11-8-15(18-10-20(2)3)21-14-7-5-4-6-13(14)19-16(21)12(11)9-17/h4-8,10H,1-3H3/b18-10+ |
| InChI Key | BZJRJZPFWMXSAG-VCHYOVAHSA-N |
| Canonical SMILES | CC1=C(C2=NC3=CC=CC=C3N2C(=C1)N=CN(C)C)C#N |
| CAS | |
| Splash | |
| Other Names | Methanimidamide, N'-(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)-N,N-dimethyl- |