Systematic / IUPAC Name: N-(3-Oxo-1,3-dihydro-2-benzofuran-5-yl)-1,2-oxazole-5-carboxamide
ID: Reference4580
Other Names: 5-Isoxazolecarboxamide, N-(1,3-dihydro-3-oxo-5-isobenzofuranyl)-
Formula: C12H8N2O4
N-(3-Oxo-1,3-dihydro-2-benzofuran-5-yl)-5-isoxazolecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 160 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/18/2016 7:55:18 AM |
| InChI | InChI=1S/C12H8N2O4/c15-11(10-3-4-13-18-10)14-8-2-1-7-6-17-12(16)9(7)5-8/h1-5H,6H2,(H,14,15) |
| InChI Key | NANYFSLJLBFCSI-UHFFFAOYSA-N |
| Canonical SMILES | C1C2=C(C=C(C=C2)NC(=O)C3=CC=NO3)C(=O)O1 |
| CAS | |
| Splash | |
| Other Names | 5-Isoxazolecarboxamide, N-(1,3-dihydro-3-oxo-5-isobenzofuranyl)- |