Systematic / IUPAC Name: 1-(3,4-Dichlorophenyl)-3-[5-(2-thienyl)-1H-pyrazol-3-yl]thiourea
ID: Reference4584
Other Names:
N-(3,4-Dichlorophenyl)-N'-[3-(2-thienyl)-1H-pyrazol-5-yl]thiourea ;
Thiourea, N-(3,4-dichlorophenyl)-N'-[5-(2-thienyl)-1H-pyrazol-3-yl]-
Formula: C14H10Cl2N4S2
N-(3,4-Dichlorophenyl)-N'-[3-(2-thienyl)-1H-pyrazol-5-yl]thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/18/2016 9:21:45 AM |
| InChI | InChI=1S/C14H10Cl2N4S2/c15-9-4-3-8(6-10(9)16)17-14(21)18-13-7-11(19-20-13)12-2-1-5-22-12/h1-7H,(H3,17,18,19,20,21) |
| InChI Key | ZFARAEWJXQDNTB-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1)C2=CC(=NN2)NC(=S)NC3=CC(=C(C=C3)Cl)Cl |
| CAS | |
| Splash | |
| Other Names |
N-(3,4-Dichlorophenyl)-N'-[3-(2-thienyl)-1H-pyrazol-5-yl]thiourea ; Thiourea, N-(3,4-dichlorophenyl)-N'-[5-(2-thienyl)-1H-pyrazol-3-yl]- |