Systematic / IUPAC Name: 1-(2-Furylmethyl)-3-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]thiourea
ID: Reference4586
Other Names: Thiourea, N-[(4,5-dihydro-3-phenyl-5-isoxazolyl)methyl]-N'-(2-furanylmethyl)-
Formula: C16H17N3O2S
N-(2-Furylmethyl)-N'-[(3-phenyl-4,5-dihydro-5-isoxazolyl)methyl]thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/18/2016 9:58:38 AM |
| InChI | InChI=1S/C16H17N3O2S/c22-16(17-10-13-7-4-8-20-13)18-11-14-9-15(19-21-14)12-5-2-1-3-6-12/h1-8,14H,9-11H2,(H2,17,18,22) |
| InChI Key | JENHCPKNUZHMMR-UHFFFAOYSA-N |
| Canonical SMILES | C1C(ON=C1C2=CC=CC=C2)CNC(=S)NCC3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | Thiourea, N-[(4,5-dihydro-3-phenyl-5-isoxazolyl)methyl]-N'-(2-furanylmethyl)- |