Systematic / IUPAC Name: 6-Methyl-2-nitro-3-pyridinyl 3-chloro-1-benzothiophene-2-carboxylate
ID: Reference4607
Other Names: Benzo[b]thiophene-2-carboxylic acid, 3-chloro-, 6-methyl-2-nitro-3-pyridinyl ester
Formula: C15H9ClN2O4S
6-Methyl-2-nitro-3-pyridyl 3-chlorobenzo[b]thiophene-2-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/22/2016 8:52:12 AM |
| InChI | InChI=1S/C15H9ClN2O4S/c1-8-6-7-10(14(17-8)18(20)21)22-15(19)13-12(16)9-4-2-3-5-11(9)23-13/h2-7H,1H3 |
| InChI Key | DBFCXDVIBDKBAA-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzo[b]thiophene-2-carboxylic acid, 3-chloro-, 6-methyl-2-nitro-3-pyridinyl ester |