Systematic / IUPAC Name: 2-({[3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)aniline
ID: Reference4618
Other Names: Benzenamine, 2-({[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}thio)-
Formula: C15H12ClN3OS
2-({[3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}thio)aniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/25/2016 8:25:31 AM |
| InChI | InChI=1S/C15H12ClN3OS/c16-11-7-5-10(6-8-11)15-18-14(20-19-15)9-21-13-4-2-1-3-12(13)17/h1-8H,9,17H2 |
| InChI Key | WMESLCACTLPGTE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)N)SCC2=NC(=NO2)C3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | Benzenamine, 2-({[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}thio)- |