Systematic / IUPAC Name: (2E)-4-(4-Methylphenyl)-4-oxo-2-butenoic acid
ID: Reference4624
Other Names:
(E)-4-(4-Methylphenyl)-4-oxo-2-butenoic acid;
(2E)-4-(4-Methylphenyl)-4-oxobut-2-enoic acid;
2-Butenoic acid,4-(4-methylphenyl)-4-oxo-, (2E)-
Formula: C11H10O3
3-(4-Methylbenzoyl)acrylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/25/2016 10:55:56 AM |
| InChI | InChI=1S/C11H10O3/c1-8-2-4-9(5-3-8)10(12)6-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-6+ |
| InChI Key | VNJMEFZKYZHWEO-VOTSOKGWSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)C=CC(=O)O |
| CAS | |
| Splash | |
| Other Names |
(E)-4-(4-Methylphenyl)-4-oxo-2-butenoic acid; (2E)-4-(4-Methylphenyl)-4-oxobut-2-enoic acid; 2-Butenoic acid,4-(4-methylphenyl)-4-oxo-, (2E)- |
| ChEMBL | CHEMBL44664 |
| ChemSpider | 602123 |
| PubChem | 691106 |