Systematic / IUPAC Name: 2-Fluoroisophthalamide
ID: Reference4626
Other Names: 1,3-Benzenedicarboxamide, 2-fluoro-
Formula: C8H7FN2O2
2-Fluoroisophthalamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/25/2016 10:57:58 AM |
| InChI | InChI=1S/C8H7FN2O2/c9-6-4(7(10)12)2-1-3-5(6)8(11)13/h1-3H,(H2,10,12)(H2,11,13) |
| InChI Key | PJLIPQLXMCEXEA-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)C(=O)N)F)C(=O)N |
| CAS | |
| Splash | |
| Other Names | 1,3-Benzenedicarboxamide, 2-fluoro- |