Systematic / IUPAC Name: 2-(3,5-Dimethyl-4-phenoxy-1H-pyrazol-1-yl)-N-[3-(methylsulfanyl)phenyl]acetamide
ID: Reference4632
Other Names: 1H-Pyrazole-1-acetamide, 3,5-dimethyl-N-[3-(methylthio)phenyl]-4-phenoxy-
Formula: C20H21N3O2S
N1-[3-(Methylthio)phenyl]-2-(3,5-dimethyl-4-phenoxy-1H-pyrazol-1-yl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/25/2016 1:10:52 PM |
| InChI | InChI=1S/C20H21N3O2S/c1-14-20(25-17-9-5-4-6-10-17)15(2)23(22-14)13-19(24)21-16-8-7-11-18(12-16)26-3/h4-12H,13H2,1-3H3,(H,21,24) |
| InChI Key | MZVLQZQRQCDSSV-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NN1CC(=O)NC2=CC(=CC=C2)SC)C)OC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrazole-1-acetamide, 3,5-dimethyl-N-[3-(methylthio)phenyl]-4-phenoxy- |