Systematic / IUPAC Name: 1-(4-Chlorophenyl)-5-methyl-N-(2-{[3-(trifluoromethyl)benzyl]sulfanyl}ethyl)-1H-pyrazole-4-carboxamide
ID: Reference4635
Other Names: 1H-Pyrazole-4-carboxamide, 1-(4-chlorophenyl)-5-methyl-N-[2-({[3-(trifluoromethyl)phenyl]methyl}thio)ethyl]-
Formula: C21H19ClF3N3OS
1-(4-Chlorophenyl)-5-methyl-N-(2-{[3-(trifluoromethyl)benzyl]sulfanyl}ethyl)-1H-pyrazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/25/2016 2:07:53 PM |
| InChI | InChI=1S/C21H19ClF3N3OS/c1-14-19(12-27-28(14)18-7-5-17(22)6-8-18)20(29)26-9-10-30-13-15-3-2-4-16(11-15)21(23,24)25/h2-8,11-12H,9-10,13H2,1H3,(H,26,29) |
| InChI Key | FQMLIOWKWPSVFW-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=NN1C2=CC=C(C=C2)Cl)C(=O)NCCSCC3=CC(=CC=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrazole-4-carboxamide, 1-(4-chlorophenyl)-5-methyl-N-[2-({[3-(trifluoromethyl)phenyl]methyl}thio)ethyl]- |
| ChEMBL | CHEMBL1508067 |
| ChemSpider | 2089037 |
| PubChem | 2810621 |