Systematic / IUPAC Name: 2-{[2-(Trifluoromethoxy)benzyl]carbamoyl}benzoic acid
ID: Reference4637
Other Names: Benzoic acid, 2-[({[2-(trifluoromethoxy)phenyl]methyl}amino)carbonyl]-
Formula: C16H12F3NO4
2-({[2-(Trifluoromethoxy)benzyl]amino}carbonyl)benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 5:52:46 AM |
| InChI | InChI=1S/C16H12F3NO4/c17-16(18,19)24-13-8-4-1-5-10(13)9-20-14(21)11-6-2-3-7-12(11)15(22)23/h1-8H,9H2,(H,20,21)(H,22,23) |
| InChI Key | HUXDWFVQDWJHGM-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)CNC(=O)C2=CC=CC=C2C(=O)O)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Benzoic acid, 2-[({[2-(trifluoromethoxy)phenyl]methyl}amino)carbonyl]- |