Systematic / IUPAC Name: 5-Methyl-N-[1-methyl-4-phenyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]-1,2-oxazole-3-carboxamide
ID: Reference4641
Other Names: 3-Isoxazolecarboxamide, 5-methyl-N-[1-methyl-4-phenyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]-
Formula: C16H13F3N4O2
5-Methyl-N-[1-methyl-4-phenyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]-3-isoxazolecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 7:31:45 AM |
| InChI | InChI=1S/C16H13F3N4O2/c1-9-8-11(22-25-9)15(24)20-14-12(10-6-4-3-5-7-10)13(16(17,18)19)21-23(14)2/h3-8H,1-2H3,(H,20,24) |
| InChI Key | QFJGLWINCBLWLY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=NO1)C(=O)NC2=C(C(=NN2C)C(F)(F)F)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 3-Isoxazolecarboxamide, 5-methyl-N-[1-methyl-4-phenyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]- |