Systematic / IUPAC Name: Ethyl 5-(4-chlorophenyl)-2-{(E)-[(2-furoyloxy)imino]methyl}-3-furoate
ID: Reference4655
Other Names: 3-Furancarboxylic acid, 5-(4-chlorophenyl)-2-((E)-{[(2-furanylcarbonyl)oxy]imino}methyl)-, ethyl ester
Formula: C19H14ClNO6
Ethyl 5-(4-chlorophenyl)-2-({[(2-furylcarbonyl)oxy]imino}methyl)-3-furoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 11:56:49 AM |
| InChI | InChI=1S/C19H14ClNO6/c1-2-24-18(22)14-10-16(12-5-7-13(20)8-6-12)26-17(14)11-21-27-19(23)15-4-3-9-25-15/h3-11H,2H2,1H3/b21-11+ |
| InChI Key | QFDDPCMFVMDEIU-SRZZPIQSSA-N |
| Canonical SMILES | CCOC(=O)C1=C(OC(=C1)C2=CC=C(C=C2)Cl)C=NOC(=O)C3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | 3-Furancarboxylic acid, 5-(4-chlorophenyl)-2-((E)-{[(2-furanylcarbonyl)oxy]imino}methyl)-, ethyl ester |