Systematic / IUPAC Name: 4-Fluoro-N-(1H-indol-5-yl)benzamide
ID: Reference4657
Other Names: Benzamide,4-fluoro-N-1H-indol-5-yl-
Formula: C15H11FN2O
4-Fluoro-N-(1H-indol-5-yl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 11:29:11 AM |
| InChI | InChI=1S/C15H11FN2O/c16-12-3-1-10(2-4-12)15(19)18-13-5-6-14-11(9-13)7-8-17-14/h1-9,17H,(H,18,19) |
| InChI Key | RQJUZWRDCVBOMH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1C(=O)NC2=CC3=C(C=C2)NC=C3)F |
| CAS | 182564416 |
| Splash | |
| Other Names | Benzamide,4-fluoro-N-1H-indol-5-yl- |
| PubChem | 2814506 |
| ChemSpider | 2092895 |
| ChEMBL | CHEMBL1541216 |