Systematic / IUPAC Name: 3-Sulfinoalanine
ID: Reference466
Other Names:
(2R)-2-Amino-3-sulfinopropanoic acid;
3-Sulfino-L-alanine;
Cysteinesulfinic acid;
L-Cysteinesulphinic acid;
L-Alanine, 3-sulfino-
Formula: C3H7NO4S
Class: Endogenous Metabolites
L-Cysteinesulfinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 351 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/23/2015 1:23:13 PM |
| InChI | InChI=1S/C3H7NO4S/c4-2(3(5)6)1-9(7)8/h2H,1,4H2,(H,5,6)(H,7,8)/t2-/m0/s1 |
| InChI Key | ADVPTQAUNPRNPO-REOHCLBHSA-N |
| Canonical SMILES | C(C(C(=O)O)N)S(=O)O |
| CAS | 1115657 |
| Splash | |
| Other Names |
(2R)-2-Amino-3-sulfinopropanoic acid; 3-Sulfino-L-alanine; Cysteinesulfinic acid; L-Cysteinesulphinic acid; L-Alanine, 3-sulfino- |
| ChEBI | CHEBI:16345 |
| KEGG | C00606 |
| ChemSpider | 1266065 |
| ChEMBL | CHEMBL1160508 |
| PubChem | 1549098 |
| Wikipedia | Cysteine_sulfinic_acid |