Systematic / IUPAC Name: Ethyl 4-(2-methoxyphenyl)-1-piperazinecarboxylate
ID: Reference4666
Other Names: 1-Piperazinecarboxylic acid, 4-(2-methoxyphenyl)-, ethyl ester
Formula: C14H20N2O3
Ethyl 4-(2-methoxyphenyl)piperazine-1-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 1:23:53 PM |
| InChI | InChI=1S/C14H20N2O3/c1-3-19-14(17)16-10-8-15(9-11-16)12-6-4-5-7-13(12)18-2/h4-7H,3,8-11H2,1-2H3 |
| InChI Key | YFDOAOHRTFGTEU-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)N1CCN(CC1)C2=CC=CC=C2OC |
| CAS | |
| Splash | |
| Other Names | 1-Piperazinecarboxylic acid, 4-(2-methoxyphenyl)-, ethyl ester |
| ChemSpider | 2022949 |
| ChEMBL | CHEMBL1867195 |
| PubChem | 2741385 |