Systematic / IUPAC Name: N-(2,4-Difluorophenyl)-4-(dimethylamino)nicotinamide
ID: Reference4667
Other Names:
3-Pyridinecarboxamide, N-(2,4-difluorophenyl)-4-(dimethylamino)-;
Pyridine-3-carboxamide, 4-dimethylamino-N-(2,4-difluorophenyl)-
Formula: C14H13F2N3O
N-(2,4-Difluorophenyl)-4-(dimethylamino)nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 1:29:19 PM |
| InChI | InChI=1S/C14H13F2N3O/c1-19(2)13-5-6-17-8-10(13)14(20)18-12-4-3-9(15)7-11(12)16/h3-8H,1-2H3,(H,18,20) |
| InChI Key | SEELEHLAUTYYQH-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1=C(C=NC=C1)C(=O)NC2=C(C=C(C=C2)F)F |
| CAS | |
| Splash | |
| Other Names |
3-Pyridinecarboxamide, N-(2,4-difluorophenyl)-4-(dimethylamino)-; Pyridine-3-carboxamide, 4-dimethylamino-N-(2,4-difluorophenyl)- |
| ChemSpider | 513628 |
| PubChem | 590845 |
| ChEMBL | CHEMBL1885144 |