Systematic / IUPAC Name: L-Cystine
ID: Reference467
Other Names:
L-α-Diamino-β-dithiolactic acid;
Bis(β-amino-β-carboxyethyl)disulfide;
(2R)-2-Amino-3-{[(2R)-2-amino-2-carboxyethyl]disulfanyl}propanoic acid;
2-Amino-3-[(2-amino-2-carboxyethyl)dithio]propanoic acid;
L-Cystin
; more
Formula: C6H12N2O4S2
Class: Endogenous Metabolites
L-Cystine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 312 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/23/2015 1:52:18 PM |
| InChI | InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| InChI Key | LEVWYRKDKASIDU-IMJSIDKUSA-N |
| Canonical SMILES | C(C(C(=O)O)N)SSCC(C(=O)O)N |
| CAS | 56893 |
| Splash | |
| Other Names |
L-α-Diamino-β-dithiolactic acid; Bis(β-amino-β-carboxyethyl)disulfide; (2R)-2-Amino-3-{[(2R)-2-amino-2-carboxyethyl]disulfanyl}propanoic acid; 2-Amino-3-[(2-amino-2-carboxyethyl)dithio]propanoic acid; L-Cystin; Dicysteine; L-Dicysteine; L-Cysteine disulfide; Cystine (L)-; L-(-)-Cystine; Cystine, L- |
| HMDb | HMDB00192 |
| PubChem | 67678 |
| KEGG | C00491; D03636 |
| ChemSpider | 60997 |
| ChEBI | CHEBI:16283; CHEBI:35491 |
| ChemIDPlus | 000349462 |
| ChEMBL | CHEMBL590540 |
| Wikipedia | Cystine |