Systematic / IUPAC Name: N-(1-Methyl-3-phenyl-1H-pyrazol-5-yl)-2-thiophenecarboxamide
ID: Reference4671
Other Names:
N-(1-Methyl-3-phenyl-1H-pyrazol-5-yl)thiophene-2-carboxamide;
2-Thiophenecarboxamide, N-(1-methyl-3-phenyl-1H-pyrazol-5-yl)-
Formula: C15H13N3OS
N-(1-Methyl-3-phenyl-1H-pyrazol-5-yl)-2-thiophenecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/27/2016 5:44:48 AM |
| InChI | InChI=1S/C15H13N3OS/c1-18-14(16-15(19)13-8-5-9-20-13)10-12(17-18)11-6-3-2-4-7-11/h2-10H,1H3,(H,16,19) |
| InChI Key | IUIQSFBTULIABA-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC=CC=C2)NC(=O)C3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names |
N-(1-Methyl-3-phenyl-1H-pyrazol-5-yl)thiophene-2-carboxamide; 2-Thiophenecarboxamide, N-(1-methyl-3-phenyl-1H-pyrazol-5-yl)- |
| PubChem | 2814958 |
| ChEMBL | CHEMBL1734304 |
| ChemSpider | 2093343 |