Systematic / IUPAC Name: Diethyl ({[4-(ethoxycarbonyl)-1,3-thiazol-2-yl]amino}methylene)malonate
ID: Reference4682
Other Names: Propanedioic acid, 2-({[4-(ethoxycarbonyl)-2-thiazolyl]amino}methylene)-, diethyl ester
Formula: C14H18N2O6S
Diethyl 2-({[4-(ethoxycarbonyl)-1,3-thiazol-2-yl]amino}methylidene)malonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/27/2016 8:57:26 AM |
| InChI | InChI=1S/C14H18N2O6S/c1-4-20-11(17)9(12(18)21-5-2)7-15-14-16-10(8-23-14)13(19)22-6-3/h7-8H,4-6H2,1-3H3,(H,15,16) |
| InChI Key | CBJGHOOLKBSHFQ-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=CSC(=N1)NC=C(C(=O)OCC)C(=O)OCC |
| CAS | |
| Splash | |
| Other Names | Propanedioic acid, 2-({[4-(ethoxycarbonyl)-2-thiazolyl]amino}methylene)-, diethyl ester |