Systematic / IUPAC Name: 8-(2-Pyridinyloxy)quinoline
ID: Reference4683
Other Names: Quinoline, 8-(2-pyridinyloxy)-
Formula: C14H10N2O
8-(2-Pyridinyloxy)quinoline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/27/2016 9:02:49 AM |
| InChI | InChI=1S/C14H10N2O/c1-2-9-15-13(8-1)17-12-7-3-5-11-6-4-10-16-14(11)12/h1-10H |
| InChI Key | WQJUGAMQYDCFQM-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=NC(=C1)OC2=CC=CC3=C2N=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Quinoline, 8-(2-pyridinyloxy)- |
| ChEMBL | CHEMBL1557429 |
| ChemSpider | 2094241 |
| PubChem | 2815881 |