Systematic / IUPAC Name: 1,1'-(1,2-Ethanediyl)bis[3-(cyclopropylmethyl)(thiourea)]
ID: Reference4693
Other Names:
N-(Cyclopropylmethyl)-N'-[2-({[(cyclopropylmethyl)amino]carbothioyl}amino)ethyl]thiourea ;
Thiourea, N,N''-1,2-ethanediylbis[N'-(cyclopropylmethyl)-
Formula: C12H22N4S2
N-(Cyclopropylmethyl)-N'-[2-({[(cyclopropylmethyl)amino]carbothioyl}amino)ethyl]thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/27/2016 12:28:57 PM |
| InChI | InChI=1S/C12H22N4S2/c17-11(15-7-9-1-2-9)13-5-6-14-12(18)16-8-10-3-4-10/h9-10H,1-8H2,(H2,13,15,17)(H2,14,16,18) |
| InChI Key | VLLIWSTYIXEHNF-UHFFFAOYSA-N |
| Canonical SMILES | C1CC1CNC(=S)NCCNC(=S)NCC2CC2 |
| CAS | |
| Splash | |
| Other Names |
N-(Cyclopropylmethyl)-N'-[2-({[(cyclopropylmethyl)amino]carbothioyl}amino)ethyl]thiourea ; Thiourea, N,N''-1,2-ethanediylbis[N'-(cyclopropylmethyl)- |