Systematic / IUPAC Name: 5-(2-Chloro-6-fluorobenzyl)-6-methyl-2-(2-propyn-1-ylsulfanyl)-4-pyrimidinyl dimethylcarbamate
ID: Reference4696
Other Names: Carbamic acid, N,N-dimethyl, 5-[(2-chloro-6-fluorophenyl)methyl]-6-methyl-2-(2-propyn-1-ylthio)-4-pyrimidinyl ester
Formula: C18H17ClFN3O2S
5-(2-Chloro-6-fluorobenzyl)-6-methyl-2-(prop-2-ynylthio)pyrimidin-4-yl N,N-dimethylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 115 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/27/2016 1:22:46 PM |
| InChI | InChI=1S/C18H17ClFN3O2S/c1-5-9-26-17-21-11(2)12(16(22-17)25-18(24)23(3)4)10-13-14(19)7-6-8-15(13)20/h1,6-8H,9-10H2,2-4H3 |
| InChI Key | DEXLNSYSVGQSMK-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NC(=N1)SCC#C)OC(=O)N(C)C)CC2=C(C=CC=C2Cl)F |
| CAS | |
| Splash | |
| Other Names | Carbamic acid, N,N-dimethyl, 5-[(2-chloro-6-fluorophenyl)methyl]-6-methyl-2-(2-propyn-1-ylthio)-4-pyrimidinyl ester |