Systematic / IUPAC Name: Ethyl 2-{[(2-furylmethyl)sulfonyl]methyl}-1,3-thiazole-4-carboxylate
ID: Reference4708
Other Names: 4-Thiazolecarboxylic acid, 2-{[(2-furanylmethyl)sulfonyl]methyl}-, ethyl ester
Formula: C12H13NO5S2
Ethyl 2-{[(2-furylmethyl)sulfonyl]methyl}-1,3-thiazole-4-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 113 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/28/2016 12:33:33 PM |
| InChI | InChI=1S/C12H13NO5S2/c1-2-17-12(14)10-6-19-11(13-10)8-20(15,16)7-9-4-3-5-18-9/h3-6H,2,7-8H2,1H3 |
| InChI Key | JWNPNENBGAMSCY-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=CSC(=N1)CS(=O)(=O)CC2=CC=CO2 |
| CAS | |
| Splash | |
| Other Names | 4-Thiazolecarboxylic acid, 2-{[(2-furanylmethyl)sulfonyl]methyl}-, ethyl ester |