Systematic / IUPAC Name: 1-Acetyl-N-[methyl(4-methylphenyl)oxido-λ6-sulfanylidene]-5-indolinesulfonamide
ID: Reference4715
Other Names: 1H-Indole-5-sulfonamide, 1-acetyl-2,3-dihydro-N-[methyl(4-methylphenyl)oxidosulfanylidene]-
Formula: C18H20N2O4S2
1-Acetyl-N-[methyl(4-methylphenyl)oxo-λ6-sulfanylidene]indoline-5-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/29/2016 8:39:22 AM |
| InChI | InChI=1S/C18H20N2O4S2/c1-13-4-6-16(7-5-13)25(3,22)19-26(23,24)17-8-9-18-15(12-17)10-11-20(18)14(2)21/h4-9,12H,10-11H2,1-3H3 |
| InChI Key | LXCSKRDJEQRHJH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)S(=NS(=O)(=O)C2=CC3=C(C=C2)N(CC3)C(=O)C)(=O)C |
| CAS | |
| Splash | |
| Other Names | 1H-Indole-5-sulfonamide, 1-acetyl-2,3-dihydro-N-[methyl(4-methylphenyl)oxidosulfanylidene]- |