Systematic / IUPAC Name: Methyl 2-amino-3-(1H-imidazol-5-yl)propanoate
ID: Reference474
Other Names:
Methyl L-histidinate;
Histidine methyl ester;
Methyl (2S)-2-amino-3-(1H-imidazol-4-yl)propanoate dihydrochloride;
L-Histidine methyl ester
Formula: C7H11N3O2
Methyl-L-histidinate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 681 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/26/2015 12:30:23 PM |
| InChI | InChI=1S/C7H11N3O2/c1-12-7(11)6(8)2-5-3-9-4-10-5/h3-4,6H,2,8H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChI Key | BXRMEWOQUXOLDH-LURJTMIESA-N |
| Canonical SMILES | COC(=O)C(CC1=CNC=N1)N |
| CAS | 1499463 |
| Splash | |
| Other Names |
Methyl L-histidinate; Histidine methyl ester; Methyl (2S)-2-amino-3-(1H-imidazol-4-yl)propanoate dihydrochloride; L-Histidine methyl ester |
| ChemSpider | 83857 |
| ChemIDPlus | 001499463 |
| ChEMBL | CHEMBL54664 |
| PubChem | 92893 |