Systematic / IUPAC Name: N-(3,4-Dimethylphenyl)-2-({[5-(2-methoxyphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetyl)hydrazinecarbothioamide
ID: Reference4744
Other Names: Acetic acid, 2-{[5-(2-methoxyphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]thio}, 2-{[(3,4-dimethylphenyl)amino]thioxomethyl}hydrazide
Formula: C26H26N6O2S2
N1-(3,4-Dimethylphenyl)-2-(2-{[5-(2-methoxyphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]thio}acetyl)hydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/9/2016 1:13:34 PM |
| InChI | InChI=1S/C26H26N6O2S2/c1-17-13-14-19(15-18(17)2)27-25(35)30-28-23(33)16-36-26-31-29-24(21-11-7-8-12-22(21)34-3)32(26)20-9-5-4-6-10-20/h4-15H,16H2,1-3H3,(H,28,33)(H2,27,30,35) |
| InChI Key | GHVOIRCQOJEWLB-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-{[5-(2-methoxyphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]thio}, 2-{[(3,4-dimethylphenyl)amino]thioxomethyl}hydrazide |