Systematic / IUPAC Name: 2-Chloro-N-{2-[(4-methylphenyl)sulfanyl]-3-pyridinyl}benzamide
ID: Reference4745
Other Names:
2-Chloro-N-{2-[(4-methylphenyl)sulfanyl]pyridin-3-yl}benzamide;
Benzamide, 2-chloro-N-{2-[(4-methylphenyl)thio]-3-pyridinyl}-
Formula: C19H15ClN2OS
2-Chloro-N-{2-[(4-methylphenyl)thio]pyridin-3-yl}benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/9/2016 1:15:18 PM |
| InChI | InChI=1S/C19H15ClN2OS/c1-13-8-10-14(11-9-13)24-19-17(7-4-12-21-19)22-18(23)15-5-2-3-6-16(15)20/h2-12H,1H3,(H,22,23) |
| InChI Key | ALJLVTZYMRNUQP-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)SC2=C(C=CC=N2)NC(=O)C3=CC=CC=C3Cl |
| CAS | |
| Splash | |
| Other Names |
2-Chloro-N-{2-[(4-methylphenyl)sulfanyl]pyridin-3-yl}benzamide; Benzamide, 2-chloro-N-{2-[(4-methylphenyl)thio]-3-pyridinyl}- |
| ChEMBL | CHEMBL1466138 |
| ChemSpider | 2010412 |
| PubChem | 2728417 |