Systematic / IUPAC Name: 1-Methyl-3-(4-phenoxyphenyl)thiourea
ID: Reference4752
Other Names:
(Methylamino)[(4-phenoxyphenyl)amino]methane-1-thione;
N-Methyl-N'-(4-phenoxyphenyl)thiourea ;
Thiourea, N-methyl-N'-(4-phenoxyphenyl)-
Formula: C14H14N2OS
N-Methyl-N'-(4-phenoxyphenyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/10/2016 8:13:54 AM |
| InChI | InChI=1S/C14H14N2OS/c1-15-14(18)16-11-7-9-13(10-8-11)17-12-5-3-2-4-6-12/h2-10H,1H3,(H2,15,16,18) |
| InChI Key | JVPIDJVSDDBOTQ-UHFFFAOYSA-N |
| Canonical SMILES | CNC(=S)NC1=CC=C(C=C1)OC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
(Methylamino)[(4-phenoxyphenyl)amino]methane-1-thione; N-Methyl-N'-(4-phenoxyphenyl)thiourea ; Thiourea, N-methyl-N'-(4-phenoxyphenyl)- |