Systematic / IUPAC Name: 1-(2-Hydroxyethyl)-3-(2-methoxybenzyl)thiourea
ID: Reference4757
Other Names:
N-(2-Hydroxyethyl)-N'-(2-methoxybenzyl)thiourea ;
Thiourea, N-(2-hydroxyethyl)-N'-[(2-methoxyphenyl)methyl]-
Formula: C11H16N2O2S
N-(2-Hydroxyethyl)-N'-(2-methoxybenzyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/10/2016 9:25:12 AM |
| InChI | InChI=1S/C11H16N2O2S/c1-15-10-5-3-2-4-9(10)8-13-11(16)12-6-7-14/h2-5,14H,6-8H2,1H3,(H2,12,13,16) |
| InChI Key | PEGICPPVSBLHFJ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC=C1CNC(=S)NCCO |
| CAS | |
| Splash | |
| Other Names |
N-(2-Hydroxyethyl)-N'-(2-methoxybenzyl)thiourea ; Thiourea, N-(2-hydroxyethyl)-N'-[(2-methoxyphenyl)methyl]- |