Systematic / IUPAC Name: N-(3-Pyridinylmethyl)-2-quinoxalinecarboxamide
ID: Reference4763
Other Names: 2-Quinoxalinecarboxamide, N-(3-pyridinylmethyl)-
Formula: C15H12N4O
N-(3-Pyridinylmethyl)-2-quinoxalinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/10/2016 10:44:36 AM |
| InChI | InChI=1S/C15H12N4O/c20-15(18-9-11-4-3-7-16-8-11)14-10-17-12-5-1-2-6-13(12)19-14/h1-8,10H,9H2,(H,18,20) |
| InChI Key | DXRBOJFUNWOHCE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)N=CC(=N2)C(=O)NCC3=CN=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 2-Quinoxalinecarboxamide, N-(3-pyridinylmethyl)- |
| ChemSpider | 2020046 |
| ChEMBL | CHEMBL1388318 |
| PubChem | 2738421 |