Systematic / IUPAC Name: (2E)-2-(2-Furoyl)-3-{[4-(trifluoromethoxy)phenyl]amino}acrylonitrile
ID: Reference4780
Other Names: 2-Furanpropanenitrile, β-oxo-α-({[4-(trifluoromethoxy)phenyl]amino}methylene)-, (αE)-
Formula: C15H9F3N2O3
2-(2-Furylcarbonyl)-3-[4-(trifluoromethoxy)anilino]acrylonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/11/2016 8:42:45 AM |
| InChI | InChI=1S/C15H9F3N2O3/c16-15(17,18)23-12-5-3-11(4-6-12)20-9-10(8-19)14(21)13-2-1-7-22-13/h1-7,9,20H/b10-9+ |
| InChI Key | QUZCCXPCVZJTQI-MDZDMXLPSA-N |
| Canonical SMILES | C1=COC(=C1)C(=O)C(=CNC2=CC=C(C=C2)OC(F)(F)F)C#N |
| CAS | |
| Splash | |
| Other Names | 2-Furanpropanenitrile, β-oxo-α-({[4-(trifluoromethoxy)phenyl]amino}methylene)-, (αE)- |