Systematic / IUPAC Name: 2-{1-[(Dimethylamino)methyl]cyclohexyl}-1-(3-fluorophenyl)ethyl 4-nitrobenzoate
ID: Reference4788
Other Names: Benzenemethanol, α-{[1-[(dimethylamino)methyl]cyclohexyl]methyl}-3-fluoro-, 4-nitrobenzoate (ester)
Formula: C24H29FN2O4
2-{1-[(Dimethylamino)methyl]cyclohexyl}-1-(3-fluorophenyl)ethyl 4-nitrobenzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/11/2016 11:23:56 AM |
| InChI | InChI=1S/C24H29FN2O4/c1-26(2)17-24(13-4-3-5-14-24)16-22(19-7-6-8-20(25)15-19)31-23(28)18-9-11-21(12-10-18)27(29)30/h6-12,15,22H,3-5,13-14,16-17H2,1-2H3 |
| InChI Key | JHQNFNFECYOANA-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzenemethanol, α-{[1-[(dimethylamino)methyl]cyclohexyl]methyl}-3-fluoro-, 4-nitrobenzoate (ester) |