Systematic / IUPAC Name: N-(5-Methyl-1,2-oxazol-3-yl)-N'-(2-oxo-3-azepanyl)ethanediamide
ID: Reference4799
Other Names: Ethanediamide, N1-(hexahydro-2-oxo-1H-azepin-3-yl)-N2-(5-methyl-3-isoxazolyl)-
Formula: C12H16N4O4
N1-(5-Methylisoxazol-3-yl)-N2-(2-oxoazepan-3-yl)ethanediamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/11/2016 2:08:16 PM |
| InChI | InChI=1S/C12H16N4O4/c1-7-6-9(16-20-7)15-12(19)11(18)14-8-4-2-3-5-13-10(8)17/h6,8H,2-5H2,1H3,(H,13,17)(H,14,18)(H,15,16,19) |
| InChI Key | SWCHPOBBWNDPRD-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=NO1)NC(=O)C(=O)NC2CCCCNC2=O |
| CAS | |
| Splash | |
| Other Names | Ethanediamide, N1-(hexahydro-2-oxo-1H-azepin-3-yl)-N2-(5-methyl-3-isoxazolyl)- |