Systematic / IUPAC Name: 2-[(5-{[(2-Anilino-2-oxoethyl)sulfanyl]methyl}-4-methyl-4H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-chlorophenyl)acetamide
ID: Reference4800
Other Names:
N-(3-Chlorophenyl)-2-{[4-methyl-5-({[(phenylcarbamoyl)methyl]sulfanyl}methyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide;
Acetamide, 2-({[5-({2-[(3-chlorophenyl)amino]-2-oxoethyl}thio)-4-methyl-4H-1,2,4-triazol-3-yl]methyl}thio)-N-phenyl-
Formula: C20H20ClN5O2S2
N1-(3-Chlorophenyl)-2-[(5-{[(2-anilino-2-oxoethyl)sulfanyl]methyl}-4-methyl-4H-1,2,4-triazol-3-yl)sulfanyl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/11/2016 2:20:44 PM |
| InChI | InChI=1S/C20H20ClN5O2S2/c1-26-17(11-29-12-18(27)22-15-7-3-2-4-8-15)24-25-20(26)30-13-19(28)23-16-9-5-6-14(21)10-16/h2-10H,11-13H2,1H3,(H,22,27)(H,23,28) |
| InChI Key | HUOHLNYREZFFSQ-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=NN=C1SCC(=O)NC2=CC(=CC=C2)Cl)CSCC(=O)NC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
N-(3-Chlorophenyl)-2-{[4-methyl-5-({[(phenylcarbamoyl)methyl]sulfanyl}methyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide; Acetamide, 2-({[5-({2-[(3-chlorophenyl)amino]-2-oxoethyl}thio)-4-methyl-4H-1,2,4-triazol-3-yl]methyl}thio)-N-phenyl- |
| PubChem | 2822783 |
| ChEMBL | CHEMBL203118 |
| ChemSpider | 2100996 |