Systematic / IUPAC Name: 4-(2-Furyl)-6-(methylsulfanyl)-2-(1-pyrrolidinyl)-5-pyrimidinecarbonitrile
ID: Reference4804
Other Names: 5-Pyrimidinecarbonitrile, 4-(2-furanyl)-6-(methylthio)-2-(1-pyrrolidinyl)-
Formula: C14H14N4OS
4-(2-Furyl)-6-(methylthio)-2-tetrahydro-1H-pyrrol-1-ylpyrimidine-5-carbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/12/2016 7:10:50 AM |
| InChI | InChI=1S/C14H14N4OS/c1-20-13-10(9-15)12(11-5-4-8-19-11)16-14(17-13)18-6-2-3-7-18/h4-5,8H,2-3,6-7H2,1H3 |
| InChI Key | RCMXJPIDPJYNIG-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=NC(=NC(=C1C#N)C2=CC=CO2)N3CCCC3 |
| CAS | |
| Splash | |
| Other Names | 5-Pyrimidinecarbonitrile, 4-(2-furanyl)-6-(methylthio)-2-(1-pyrrolidinyl)- |